cas: 1077-95-8 — see every product listed under this CAS number, including other names
5-Chloro-1H-indazole-3-carboxylic acid 97% (CAS 1077-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A128251-100mg |
| cas | 1077-95-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1054.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A128251 |
5-chloro-1H-indazole-3-carboxylic acid (CAS 1077-95-8) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 5-chloro-1H-indazole-3-carboxylic acid. InChIKey: WHAJIAULUPQHHZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 5-chloro-1H-indazole-3-carboxylic acid |
| InChIKey | WHAJIAULUPQHHZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)