Products 1077-95-8
CAS 1077-95-8 appears in our catalog under these names: 5-Chloro-1h-indazole-3-carboxylic acid, 95%, 5-Chloro-2h-indazole-3-carboxylic acid, 95%, 5–Chloro–1H–indazole–3–carboxylic acid, 5-Chloro-1H-indazole-3-carboxylic acid 97%, 5-Chloro-1H-indazole-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 25g, 1g, 10g, 100mg.
5-chloro-1H-indazole-3-carboxylic acid (CAS 1077-95-8) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 5-chloro-1H-indazole-3-carboxylic acid. InChIKey: WHAJIAULUPQHHZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 5-chloro-1H-indazole-3-carboxylic acid |
| InChIKey | WHAJIAULUPQHHZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)