cas: 147249-29-4 — see every product listed under this CAS number, including other names
5-Chloro-2-(2,2,2-trifluoroethoxy)benzonitrile 95% (CAS 147249-29-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1011824-100mg |
| cas | 147249-29-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 709.69 Pln | |
| Ambeed | 250mg | 976.69 Pln | |
| Ambeed | 1g | 1905.62 Pln | |
| Ambeed | 5g | 4258.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1011824 |
5-chloro-2-(2,2,2-trifluoroethoxy)benzonitrile (CAS 147249-29-4) is a chemical compound with the molecular formula C9H5ClF3NO and a molecular weight of 235.59 g/mol. IUPAC name: 5-chloro-2-(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: OECCDDSFWRRZFB-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3NO |
|---|---|
| Molecular weight | 235.59 g/mol |
| IUPAC name | 5-chloro-2-(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | OECCDDSFWRRZFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C#N)OCC(F)(F)F |
Computed by PubChem (NCBI)