Products 865657-82-5
CAS 865657-82-5 is the registry number for 3-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2-propyn-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]prop-2-yn-1-ol (CAS 865657-82-5) is a chemical compound with the molecular formula C9H5ClF3NO and a molecular weight of 235.59 g/mol. IUPAC name: 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]prop-2-yn-1-ol. InChIKey: RRZNCZWASLQMPN-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3NO |
|---|---|
| Molecular weight | 235.59 g/mol |
| IUPAC name | 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]prop-2-yn-1-ol |
| InChIKey | RRZNCZWASLQMPN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C#CCO)C(F)(F)F |
Computed by PubChem (NCBI)