Products 131337-75-2
CAS 131337-75-2 appears in our catalog under these names: 2-(Chloromethyl)-5-(trifluoromethyl)-1,3-benzoxazole, 2-(Chloromethyl)-5-(trifluoromethyl)-1,3-benzoxazole, 96%, 2-(Chloromethyl)-5-(trifluoromethyl)benzo(d)oxazole, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 10g, 1g, 250mg.
2-(chloromethyl)-5-(trifluoromethyl)-1,3-benzoxazole (CAS 131337-75-2) is a chemical compound with the molecular formula C9H5ClF3NO and a molecular weight of 235.59 g/mol. IUPAC name: 2-(chloromethyl)-5-(trifluoromethyl)-1,3-benzoxazole. InChIKey: PSLXDVMPZACQOM-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3NO |
|---|---|
| Molecular weight | 235.59 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | PSLXDVMPZACQOM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(O2)CCl |
Computed by PubChem (NCBI)