cas: 3507-41-3 — see every product listed under this CAS number, including other names
5-Chloro-2-(methylthio)benzo[d]thiazole, 97%, 97% (CAS 3507-41-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MLX-1g |
| cas | 3507-41-3 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 952.40 Pln | |
| Chemat | 200mg | 122.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-methylsulfanyl-1,3-benzothiazole (CAS 3507-41-3) is a chemical compound with the molecular formula C8H6ClNS2 and a molecular weight of 215.7 g/mol. IUPAC name: 5-chloro-2-methylsulfanyl-1,3-benzothiazole. InChIKey: YINRVZUJQJFNES-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNS2 |
|---|---|
| Molecular weight | 215.7 g/mol |
| IUPAC name | 5-chloro-2-methylsulfanyl-1,3-benzothiazole |
| InChIKey | YINRVZUJQJFNES-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)