CAS 54679-16-2 appears in our catalog under these names: 4-(Chloromethyl)-2-(2-thienyl)-1,3-thiazole, 95%, 4-(Chloromethyl)-2-(2-thienyl)-1,3-thiazole, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 10g, 1g, 250mg, 5g.
4-(chloromethyl)-2-thiophen-2-yl-1,3-thiazole (CAS 54679-16-2) is a chemical compound with the molecular formula C8H6ClNS2 and a molecular weight of 215.7 g/mol. IUPAC name: 4-(chloromethyl)-2-thiophen-2-yl-1,3-thiazole. InChIKey: CGJJBHKYGNSTDK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNS2 |
|---|---|
| Molecular weight | 215.7 g/mol |
| IUPAC name | 4-(chloromethyl)-2-thiophen-2-yl-1,3-thiazole |
| InChIKey | CGJJBHKYGNSTDK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)