CAS 854084-75-6 is the registry number for 2-Chloro-6-(methylthio)benzo(d)thiazole, 97%. Offered by: AmBeed. Available pack sizes: 10g.
2-chloro-6-methylsulfanyl-1,3-benzothiazole (CAS 854084-75-6) is a chemical compound with the molecular formula C8H6ClNS2 and a molecular weight of 215.7 g/mol. IUPAC name: 2-chloro-6-methylsulfanyl-1,3-benzothiazole. InChIKey: AEEGDQHVLRPQRX-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNS2 |
|---|---|
| Molecular weight | 215.7 g/mol |
| IUPAC name | 2-chloro-6-methylsulfanyl-1,3-benzothiazole |
| InChIKey | AEEGDQHVLRPQRX-UHFFFAOYSA-N |
| SMILES | CSC1=CC2=C(C=C1)N=C(S2)Cl |
Computed by PubChem (NCBI)