cas: 1593360-08-7 — see every product listed under this CAS number, including other names
5-Chloro-2-ethoxypyridine-4-carboxylic acid (CAS 1593360-08-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631458-1G |
| cas | 1593360-08-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4392.22 Pln | |
| Fluorochem | 5g | 13045.42 Pln |
| delivery time | 3-4 weeks |
|---|
5-chloro-2-ethoxypyridine-4-carboxylic acid (CAS 1593360-08-7) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 5-chloro-2-ethoxypyridine-4-carboxylic acid. InChIKey: SBQPYXDMQNUYEU-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 5-chloro-2-ethoxypyridine-4-carboxylic acid |
| InChIKey | SBQPYXDMQNUYEU-UHFFFAOYSA-N |
| SMILES | CCOC1=NC=C(C(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)