CAS 1134777-22-2 appears in our catalog under these names: Methyl 5-chloro-6-(hydroxymethyl)nicotinate, 95%, 5-chloro-6-(hydroxymethyl)-3-Pyridinecarboxylic acid methyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Methyl 5-chloro-6-(hydroxymethyl)pyridine-3-carboxylate (CAS 1134777-22-2) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: methyl 5-chloro-6-(hydroxymethyl)pyridine-3-carboxylate. InChIKey: CZCOMAQHRVALHU-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | methyl 5-chloro-6-(hydroxymethyl)pyridine-3-carboxylate |
| InChIKey | CZCOMAQHRVALHU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)CO)Cl |
Computed by PubChem (NCBI)