cas: 21427-61-2 — see every product listed under this CAS number, including other names
5-Chloro-2-hydroxy-3-nitropyridine 95% (CAS 21427-61-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 5g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208914-500g |
| cas | 21427-61-2 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 1555.19 Pln | |
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 100g | 442.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A208914 |
5-chloro-3-nitro-1H-pyridin-2-one (CAS 21427-61-2) is a chemical compound with the molecular formula C5H3ClN2O3 and a molecular weight of 174.54 g/mol. IUPAC name: 5-chloro-3-nitro-1H-pyridin-2-one. InChIKey: QVGQNICXNZMXQA-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O3 |
|---|---|
| Molecular weight | 174.54 g/mol |
| IUPAC name | 5-chloro-3-nitro-1H-pyridin-2-one |
| InChIKey | QVGQNICXNZMXQA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)