cas: 635305-45-2 — see every product listed under this CAS number, including other names
5-Chloro-2-methoxyphenylboronic acid pinacol ester, 95%, 95% (CAS 635305-45-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JI9A-1g |
| cas | 635305-45-2 |
| size | 1g |
| availability | 275g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 568.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(5-chloro-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 635305-45-2) is a chemical compound with the molecular formula C13H18BClO3 and a molecular weight of 268.54 g/mol. IUPAC name: 2-(5-chloro-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DYCAJFGGKYQESZ-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO3 |
|---|---|
| Molecular weight | 268.54 g/mol |
| IUPAC name | 2-(5-chloro-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DYCAJFGGKYQESZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)OC |
Computed by PubChem (NCBI)