cas: 93-67-4 — see every product listed under this CAS number, including other names
5-Chloro-2-phenoxyaniline 97% (CAS 93-67-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A219024-5g |
| cas | 93-67-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 648.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A219024 |
5-chloro-2-phenoxyaniline (CAS 93-67-4) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 5-chloro-2-phenoxyaniline. InChIKey: SXEBHIMOUHBBOS-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 5-chloro-2-phenoxyaniline |
| InChIKey | SXEBHIMOUHBBOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)