5-Chloro-2-phenylpyridine, 97%
cas: 58254-76-5 — see every product listed under this CAS number, including other names
5-Chloro-2-phenylpyridine, 97% (CAS 58254-76-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A985270-250mg |
| cas | 58254-76-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Ambeed | 5g | 2506.38 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 923.60 Pln | |
| Chemat | 5g | 3064.40 Pln | |
| Fluorochem | 1g | 820.56 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 841.95 Pln | |
| BLDpharm | 5g | 2696.85 Pln | |
| Fluorochem | 5g | 2590.77 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5-chloro-2-phenylpyridine (CAS 58254-76-5) is a chemical compound with the molecular formula C11H8ClN and a molecular weight of 189.64 g/mol. IUPAC name: 5-chloro-2-phenylpyridine. InChIKey: UCMPFHHXFOSHSE-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 5-chloro-2-phenylpyridine |
| InChIKey | UCMPFHHXFOSHSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)