cas: 350997-70-5 — see every product listed under this CAS number, including other names
5-Chloro-3-methyl-1-(4-methylphenyl)-1H-pyrazole-4-carbaldehyde, 95%, 95% (CAS 350997-70-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MO2-250mg |
| cas | 350997-70-5 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 2229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-3-methyl-1-(4-methylphenyl)pyrazole-4-carbaldehyde (CAS 350997-70-5) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 5-chloro-3-methyl-1-(4-methylphenyl)pyrazole-4-carbaldehyde. InChIKey: KQWYKJSWCFJJFS-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 5-chloro-3-methyl-1-(4-methylphenyl)pyrazole-4-carbaldehyde |
| InChIKey | KQWYKJSWCFJJFS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=C(C(=N2)C)C=O)Cl |
Computed by PubChem (NCBI)