CAS 2274-89-7 appears in our catalog under these names: 5-Chloro-4-nitro-2,1,3-benzothiadiazole, 5-Chloro-4-nitrobenzo[c][1,2,5]thiadiazole, 95%, 95%, 5-Chloro-4-nitrobenzo[c][1,2,5]thiadiazole, 95%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg.
5-chloro-4-nitro-2,1,3-benzothiadiazole (CAS 2274-89-7) is a chemical compound with the molecular formula C6H2ClN3O2S and a molecular weight of 215.62 g/mol. IUPAC name: 5-chloro-4-nitro-2,1,3-benzothiadiazole. InChIKey: MSDMEVQEACHYNS-UHFFFAOYSA-N.
| Molecular formula | C6H2ClN3O2S |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | 5-chloro-4-nitro-2,1,3-benzothiadiazole |
| InChIKey | MSDMEVQEACHYNS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)