CAS 857970-02-6 appears in our catalog under these names: 2-Chloro-6-nitrothiazolo[4,5-b]pyridine, 98%, 98%, 2-chloro-6-nitro-Thiazolo[4,5-b]pyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-6-nitro-[1,3]thiazolo[4,5-b]pyridine (CAS 857970-02-6) is a chemical compound with the molecular formula C6H2ClN3O2S and a molecular weight of 215.62 g/mol. IUPAC name: 2-chloro-6-nitro-[1,3]thiazolo[4,5-b]pyridine. InChIKey: ZAWXFDQGLNLZGS-UHFFFAOYSA-N.
| Molecular formula | C6H2ClN3O2S |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | 2-chloro-6-nitro-[1,3]thiazolo[4,5-b]pyridine |
| InChIKey | ZAWXFDQGLNLZGS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1SC(=N2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)