CAS 2207-33-2 appears in our catalog under these names: 5-Chloro-6-nitrobenzo[c][1,2,5]thiadiazole, 95%, 5-Chloro-6-nitrobenzo(c)(1,2,5)thiadiazole, 5-Chloro-6-nitrobenzo[c][1,2,5]thiadiazole 95%, 5-Chloro-6-nitro-2,1,3-benzothiadiazole, 95%, 95%, 5-CHLORO-6-NITROBENZO[C][1,2,5]THIADIAZOLE, ≥95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-chloro-6-nitro-2,1,3-benzothiadiazole (CAS 2207-33-2) is a chemical compound with the molecular formula C6H2ClN3O2S and a molecular weight of 215.62 g/mol. IUPAC name: 5-chloro-6-nitro-2,1,3-benzothiadiazole. InChIKey: RDUCQSRMZQZCMX-UHFFFAOYSA-N.
| Molecular formula | C6H2ClN3O2S |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | 5-chloro-6-nitro-2,1,3-benzothiadiazole |
| InChIKey | RDUCQSRMZQZCMX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=NSN=C21)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)