cas: 98142-23-5 — see every product listed under this CAS number, including other names
5-Chloro-N-methyl-3-nitropyridin-2-amine, 97% (CAS 98142-23-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F605322-250MG |
| cas | 98142-23-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 653.95 Pln | |
| Fluorochem | 5g | 2189.87 Pln | |
| Fluorochem | 10g | 4319.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-N-methyl-3-nitropyridin-2-amine (CAS 98142-23-5) is a chemical compound with the molecular formula C6H6ClN3O2 and a molecular weight of 187.58 g/mol. IUPAC name: 5-chloro-N-methyl-3-nitropyridin-2-amine. InChIKey: SYQICYDWDKINOO-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O2 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 5-chloro-N-methyl-3-nitropyridin-2-amine |
| InChIKey | SYQICYDWDKINOO-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)