Products 1256789-77-1
CAS 1256789-77-1 is the registry number for 5-Cyano-2-methylnicotinic acid, 95% （contains~7.0% solvent）. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-cyano-2-methylpyridine-3-carboxylic acid (CAS 1256789-77-1) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 5-cyano-2-methylpyridine-3-carboxylic acid. InChIKey: SOMNHSWRZODVSQ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-cyano-2-methylpyridine-3-carboxylic acid |
| InChIKey | SOMNHSWRZODVSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)C#N)C(=O)O |
Computed by PubChem (NCBI)