cas: 13039-56-0 — see every product listed under this CAS number, including other names
5-Deoxy-L-arabinose, ≥95%, ≥95% (CAS 13039-56-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UD0-10mg |
| cas | 13039-56-0 |
| size | 10mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 486.80 Pln | |
| Chemat | 50mg | 626.00 Pln | |
| Chemat | 100mg | 899.60 Pln | |
| Chemat | 250mg | 1936.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2R,3S,4S)-2,3,4-trihydroxypentanal (CAS 13039-56-0) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2R,3S,4S)-2,3,4-trihydroxypentanal. InChIKey: WDRISBUVHBMJEF-YUPRTTJUSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2R,3S,4S)-2,3,4-trihydroxypentanal |
| InChIKey | WDRISBUVHBMJEF-YUPRTTJUSA-N |
| SMILES | C[C@@H]([C@@H]([C@H](C=O)O)O)O |
Computed by PubChem (NCBI)