Products 203626-61-3
CAS 203626-61-3 appears in our catalog under these names: 5–Ethoxyisophthalic acid, 5-Ethoxyisophthalic acid, 98%, 98%, 5-Ethoxyisophthalic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 2.5g.
5-ethoxybenzene-1,3-dicarboxylic acid (CAS 203626-61-3) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 5-ethoxybenzene-1,3-dicarboxylic acid. InChIKey: WQONHTZYNXJZIC-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 5-ethoxybenzene-1,3-dicarboxylic acid |
| InChIKey | WQONHTZYNXJZIC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)