CAS 1829-60-3 appears in our catalog under these names: 7-Oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid dimethyl ester, 95%, Dimethyl 7-Oxabicyclo(2.2.1)hepta-2,5-diene-2,3-dicarboxylate, 95% GC, Dimethyl 7–Oxabicyclo(2·2·1)hepta–2,5–diene–2,3–dicarboxylate, Dimethyl 7-Oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate, >95.0%(GC), Dimethyl 7-Oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 200mg, 25g.
Dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (CAS 1829-60-3) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate. InChIKey: FQVSHUVBNGSEJO-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| InChIKey | FQVSHUVBNGSEJO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2C=CC1O2)C(=O)OC |
Computed by PubChem (NCBI)