CAS 13036-02-7 appears in our catalog under these names: Dimethyl 5-hydroxyisophthalate, 98%, Dimethyl 5-Hydroxyisophthalate, >95% (HPLC), Dimethyl 5–hydroxyisophthalate, Dimethyl 5-hydroxyisophthalate, 98% , Dimethyl 5-Hydroxyisophthalate, >98.0%(GC)(T). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100g, 25g, 5g, 500g, 10g, 250g, 50g, 1000g.
Dimethyl 5-hydroxybenzene-1,3-dicarboxylate (CAS 13036-02-7) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 5-hydroxybenzene-1,3-dicarboxylate. InChIKey: DOSDTCPDBPRFHQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 5-hydroxybenzene-1,3-dicarboxylate |
| InChIKey | DOSDTCPDBPRFHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)O)C(=O)OC |
Computed by PubChem (NCBI)