cas: 1267882-46-1 — see every product listed under this CAS number, including other names
5-Ethyl-1-(2-fluorobenzyl)-1H-1,2,3-triazole-4-carboxylic acid, 97% (CAS 1267882-46-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A406830-100mg |
| cas | 1267882-46-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 387.06 Pln | |
| Ambeed | 250mg | 709.69 Pln | |
| Ambeed | 1g | 1861.13 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 758.65 Pln | |
| BLDpharm | 1g | 2002.65 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1715.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5-ethyl-1-[(2-fluorophenyl)methyl]triazole-4-carboxylic acid (CAS 1267882-46-1) is a chemical compound with the molecular formula C12H12FN3O2 and a molecular weight of 249.24 g/mol. IUPAC name: 5-ethyl-1-[(2-fluorophenyl)methyl]triazole-4-carboxylic acid. InChIKey: IDAWCRFYLDGQPQ-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3O2 |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | 5-ethyl-1-[(2-fluorophenyl)methyl]triazole-4-carboxylic acid |
| InChIKey | IDAWCRFYLDGQPQ-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=NN1CC2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)