Products 1094246-15-7

CAS 1094246-15-7 is the registry number for 5-Ethyl-1-(2-fluoro-4-methylphenyl)-1h-1,2,3-triazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-ethyl-1-(2-fluoro-4-methylphenyl)triazole-4-carboxylic acid (CAS 1094246-15-7) is a chemical compound with the molecular formula C12H12FN3O2 and a molecular weight of 249.24 g/mol. IUPAC name: 5-ethyl-1-(2-fluoro-4-methylphenyl)triazole-4-carboxylic acid. InChIKey: SDRPXFKCMJUTET-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12FN3O2
Molecular weight249.24 g/mol
IUPAC name5-ethyl-1-(2-fluoro-4-methylphenyl)triazole-4-carboxylic acid
InChIKeySDRPXFKCMJUTET-UHFFFAOYSA-N
SMILESCCC1=C(N=NN1C2=C(C=C(C=C2)C)F)C(=O)O

Computed by PubChem (NCBI)