CAS 1142202-58-1 appears in our catalog under these names: 3-[1-(3-Fluorophenyl)-3-methyl-1h-1,2,4-triazol-5-yl]propanoic acid, 95%, 3-(1-(3-Fluorophenyl)-3-methyl-1H-1,2,4-triazol-5-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-[2-(3-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]propanoic acid (CAS 1142202-58-1) is a chemical compound with the molecular formula C12H12FN3O2 and a molecular weight of 249.24 g/mol. IUPAC name: 3-[2-(3-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]propanoic acid. InChIKey: ZPSCWQLDLBCAMU-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3O2 |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | 3-[2-(3-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]propanoic acid |
| InChIKey | ZPSCWQLDLBCAMU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)CCC(=O)O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)