5-Ethyl-2-(2-methylbenzamido)thiophene-3-carboxylic acid, 95%
cas: 380645-32-9 — see every product listed under this CAS number, including other names
5-Ethyl-2-(2-methylbenzamido)thiophene-3-carboxylic acid, 95% (CAS 380645-32-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1010673-250mg |
| cas | 380645-32-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1104.63 Pln | |
| Ambeed | 5g | 4202.94 Pln | |
| BLDpharm | 100mg | 297.70 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 1080.76 Pln | |
| BLDpharm | 5g | 4113.02 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Fluorochem | 100mg | 367.60 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 1g | 1393.28 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-ethyl-2-[(2-methylbenzoyl)amino]thiophene-3-carboxylic acid (CAS 380645-32-9) is a chemical compound with the molecular formula C15H15NO3S and a molecular weight of 289.4 g/mol. IUPAC name: 5-ethyl-2-[(2-methylbenzoyl)amino]thiophene-3-carboxylic acid. InChIKey: NMQDCEOFECGROZ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 5-ethyl-2-[(2-methylbenzoyl)amino]thiophene-3-carboxylic acid |
| InChIKey | NMQDCEOFECGROZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(S1)NC(=O)C2=CC=CC=C2C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-ethyl-2-(2-methylbenzamido)thiophene-3-carboxylic acid, 5-ethyl-2-[(2-methylbenzoyl)amino]thiophene-3-carboxylic Acid, Oprea1_841118, 5-ethyl-2-{[(2-methylphenyl)carbonyl]amino}thiophene-3-carboxylic acid, 5-ethyl-2-(2-methylbenzamido)thiophene-3-carboxylicacid, 5-ethyl-2-[(2-methylbenzene)amido]thiophene-3-carboxylic acid