CAS 146448-53-5 is the registry number for 2-Methyl-N-((4-methylphenyl)sulfonyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
2-methyl-N-(4-methylphenyl)sulfonylbenzamide (CAS 146448-53-5) is a chemical compound with the molecular formula C15H15NO3S and a molecular weight of 289.4 g/mol. IUPAC name: 2-methyl-N-(4-methylphenyl)sulfonylbenzamide. InChIKey: LVGOSRSGAWSLMB-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 2-methyl-N-(4-methylphenyl)sulfonylbenzamide |
| InChIKey | LVGOSRSGAWSLMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)C2=CC=CC=C2C |
Computed by PubChem (NCBI)