CAS 438199-49-6 is the registry number for Methyl 2-amino-7-methoxy-4,5-dihydronaphtho[2,1-b]thiophene-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Methyl 2-amino-7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate (CAS 438199-49-6) is a chemical compound with the molecular formula C15H15NO3S and a molecular weight of 289.4 g/mol. IUPAC name: methyl 2-amino-7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate. InChIKey: RITWADYAQOVYSI-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | methyl 2-amino-7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate |
| InChIKey | RITWADYAQOVYSI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(CC2)SC(=C3C(=O)OC)N |
Computed by PubChem (NCBI)