cas: 2227272-78-6 — see every product listed under this CAS number, including other names
5-Ethynyl-3-phenylpyrazin-2-amine, 95%, 95% (CAS 2227272-78-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K9P5-50mg |
| cas | 2227272-78-6 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 395.60 Pln | |
| Chemat | 100mg | 616.40 Pln | |
| Chemat | 250mg | 1182.80 Pln | |
| Chemat | 1g | 2877.20 Pln | |
| Chemat | 5g | 11829.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-ethynyl-3-phenylpyrazin-2-amine (CAS 2227272-78-6) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 5-ethynyl-3-phenylpyrazin-2-amine. InChIKey: MFMHXFKGIHUKAO-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-ethynyl-3-phenylpyrazin-2-amine |
| InChIKey | MFMHXFKGIHUKAO-UHFFFAOYSA-N |
| SMILES | C#CC1=CN=C(C(=N1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)