cas: 77180-80-4 — see every product listed under this CAS number, including other names
5-Fluoro-1-((2R,3R,4R,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)pyrimidine-2,4(1H,3H)-dione, 95+%, 95+% (CAS 77180-80-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FXSY-1g |
| cas | 77180-80-4 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 246.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione (CAS 77180-80-4) is a chemical compound with the molecular formula C9H11FN2O6 and a molecular weight of 262.19 g/mol. IUPAC name: 5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione. InChIKey: IXJSKGVGPNZCGA-UAKXSSHOSA-N.
| Molecular formula | C9H11FN2O6 |
|---|---|
| Molecular weight | 262.19 g/mol |
| IUPAC name | 5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione |
| InChIKey | IXJSKGVGPNZCGA-UAKXSSHOSA-N |
| SMILES | C1[C@H]([C@H]([C@H]([C@@H](O1)N2C=C(C(=O)NC2=O)F)O)O)O |
Computed by PubChem (NCBI)