cas: 77180-80-4 — see every product listed under this CAS number, including other names
5-Fluorouridine 95+% (CAS 77180-80-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A464060-1g |
| cas | 77180-80-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 787.56 Pln | |
| Ambeed | 25g | 2217.12 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A464060 |
5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione (CAS 77180-80-4) is a chemical compound with the molecular formula C9H11FN2O6 and a molecular weight of 262.19 g/mol. IUPAC name: 5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione. InChIKey: IXJSKGVGPNZCGA-UAKXSSHOSA-N.
| Molecular formula | C9H11FN2O6 |
|---|---|
| Molecular weight | 262.19 g/mol |
| IUPAC name | 5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione |
| InChIKey | IXJSKGVGPNZCGA-UAKXSSHOSA-N |
| SMILES | C1[C@H]([C@H]([C@H]([C@@H](O1)N2C=C(C(=O)NC2=O)F)O)O)O |
Computed by PubChem (NCBI)