CAS 77180-80-4 appears in our catalog under these names: 5-Fluorouridine, 5-Fluorouridine 95+%, 5-Fluoro-1-((2R,3R,4R,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)pyrimidine-2,4(1H,3H)-dione, 95+%, 95+%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 1g.
5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione (CAS 77180-80-4) is a chemical compound with the molecular formula C9H11FN2O6 and a molecular weight of 262.19 g/mol. IUPAC name: 5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione. InChIKey: IXJSKGVGPNZCGA-UAKXSSHOSA-N.
| Molecular formula | C9H11FN2O6 |
|---|---|
| Molecular weight | 262.19 g/mol |
| IUPAC name | 5-fluoro-1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]pyrimidine-2,4-dione |
| InChIKey | IXJSKGVGPNZCGA-UAKXSSHOSA-N |
| SMILES | C1[C@H]([C@H]([C@H]([C@@H](O1)N2C=C(C(=O)NC2=O)F)O)O)O |
Computed by PubChem (NCBI)