cas: 2338-71-8 — see every product listed under this CAS number, including other names
5-Fluoro-1H-indole-3-carbaldehyde, 96% (CAS 2338-71-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A297639-1g |
| cas | 2338-71-8 |
| size | 1g |
| availability | USA Stock: 1.65g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 148.12 Pln | |
| AmBeed | 5g | 428.05 Pln | |
| AmBeed | 25g | 1502.20 Pln | |
| AmBeed | 10g | 779.59 Pln | |
| AmBeed | 250mg | 127.29 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
5-fluoro-1H-indole-3-carbaldehyde (CAS 2338-71-8) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 5-fluoro-1H-indole-3-carbaldehyde. InChIKey: YUAJKGBLPVLADK-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 5-fluoro-1H-indole-3-carbaldehyde |
| InChIKey | YUAJKGBLPVLADK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)C=O |
Computed by PubChem (NCBI)