5-Fluoro-2,4-dinitroaniline, 98%
cas: 367-81-7 — see every product listed under this CAS number, including other names
5-Fluoro-2,4-dinitroaniline, 98% (CAS 367-81-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F034737-1G |
| cas | 367-81-7 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 25g | 1705.67 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 420.44 Pln | |
| Ambeed | 10g | 731.94 Pln | |
| Ambeed | 25g | 1399.44 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 447.64 Pln | |
| BLDpharm | 10g | 780.86 Pln | |
| BLDpharm | 25g | 1502.83 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
5-fluoro-2,4-dinitroaniline (CAS 367-81-7) is a chemical compound with the molecular formula C6H4FN3O4 and a molecular weight of 201.11 g/mol. IUPAC name: 5-fluoro-2,4-dinitroaniline. InChIKey: RAGRTYREMCPEIV-UHFFFAOYSA-N.
| Molecular formula | C6H4FN3O4 |
|---|---|
| Molecular weight | 201.11 g/mol |
| IUPAC name | 5-fluoro-2,4-dinitroaniline |
| InChIKey | RAGRTYREMCPEIV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)