CAS 367-78-2 appears in our catalog under these names: 2-Fluoro-4,6-dinitroaniline, 97%, 2-Fluoro-4,6-dinitroaniline 98%, 2-FLUORO-4,6-DINITROANILINE, 98%, 2-Fluoro-4,6-dinitrobenzenamine, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 250mg, 5g, 100mg.
2-fluoro-4,6-dinitroaniline (CAS 367-78-2) is a chemical compound with the molecular formula C6H4FN3O4 and a molecular weight of 201.11 g/mol. IUPAC name: 2-fluoro-4,6-dinitroaniline. InChIKey: RKDWBNIFALNXQD-UHFFFAOYSA-N.
| Molecular formula | C6H4FN3O4 |
|---|---|
| Molecular weight | 201.11 g/mol |
| IUPAC name | 2-fluoro-4,6-dinitroaniline |
| InChIKey | RKDWBNIFALNXQD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)