CAS 367-81-7 appears in our catalog under these names: 2,4-Dinitro-5-fluoroaniline, 98%, 2,4–Dinitro–5–fluoroaniline, 2,4-Dinitro-5-fluoroaniline, >98.0%(GC), 5-Fluoro-2,4-dinitroaniline 98%, 5-Fluoro-2,4-dinitroaniline, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 10g.
5-fluoro-2,4-dinitroaniline (CAS 367-81-7) is a chemical compound with the molecular formula C6H4FN3O4 and a molecular weight of 201.11 g/mol. IUPAC name: 5-fluoro-2,4-dinitroaniline. InChIKey: RAGRTYREMCPEIV-UHFFFAOYSA-N.
| Molecular formula | C6H4FN3O4 |
|---|---|
| Molecular weight | 201.11 g/mol |
| IUPAC name | 5-fluoro-2,4-dinitroaniline |
| InChIKey | RAGRTYREMCPEIV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)