cas: 915763-87-0 — see every product listed under this CAS number, including other names
5-Fluoro-2-(trifluoromethyl)benzenesulfonyl chloride, 95%, 95% (CAS 915763-87-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGRS-250mg |
| cas | 915763-87-0 |
| size | 250mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 760.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 915763-87-0) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: DRXFNKKEESCKSG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O2S |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | DRXFNKKEESCKSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)