Products 1177009-38-9

CAS 1177009-38-9 appears in our catalog under these names: 2-Fluoro-4-(trifluoromethyl)benzene-1-sulfonyl chloride, 97%, 2-Fluoro-4-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

2-fluoro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS 1177009-38-9) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: FNYJQRYWXHLCSX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClF4O2S
Molecular weight262.61 g/mol
IUPAC name2-fluoro-4-(trifluoromethyl)benzenesulfonyl chloride
InChIKeyFNYJQRYWXHLCSX-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)