CAS 915763-87-0 appears in our catalog under these names: 5-Fluoro-2-(trifluoromethyl)benzenesulfonyl chloride, 95%, 5-Fluoro-2-(trifluoromethyl)benzenesulfonyl chloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
5-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 915763-87-0) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: DRXFNKKEESCKSG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O2S |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | DRXFNKKEESCKSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)