cas: 1192023-08-7 — see every product listed under this CAS number, including other names
5-Fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97% (CAS 1192023-08-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216130-100MG |
| cas | 1192023-08-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 862.21 Pln | |
| Fluorochem | 250mg | 1372.45 Pln | |
| Fluorochem | 1g | 3309.27 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1192023-08-7) is a chemical compound with the molecular formula C14H17BFNO2 and a molecular weight of 261.10 g/mol. IUPAC name: 5-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: HTUJWJWTEQBFEF-UHFFFAOYSA-N.
| Molecular formula | C14H17BFNO2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 5-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | HTUJWJWTEQBFEF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)C#N)C |
Computed by PubChem (NCBI)