cas: 779345-37-8 — see every product listed under this CAS number, including other names
5-Fluoro-2-nitropyridine, 98%, 98% (CAS 779345-37-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MRB-250mg |
| cas | 779345-37-8 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1749.20 Pln | |
| Chemat | 100g | 2987.60 Pln | |
| Chemat | 250g | 3746.00 Pln | |
| Chemat | 500g | 6398.40 Pln | |
| Chemat | 1kg | 10878.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-nitropyridine (CAS 779345-37-8) is a chemical compound with the molecular formula C5H3FN2O2 and a molecular weight of 142.09 g/mol. IUPAC name: 5-fluoro-2-nitropyridine. InChIKey: CGFYNRVHPARGFY-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O2 |
|---|---|
| Molecular weight | 142.09 g/mol |
| IUPAC name | 5-fluoro-2-nitropyridine |
| InChIKey | CGFYNRVHPARGFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)