cas: 2306268-35-7 — see every product listed under this CAS number, including other names
5-Fluoroindolin-7-amine dihydrochloride, 97%, 97% (CAS 2306268-35-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JURF-100mg |
| cas | 2306268-35-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 500mg | 851.60 Pln | |
| Chemat | 1g | 1250.00 Pln | |
| Chemat | 5g | 3626.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2,3-dihydro-1H-indol-7-amine;dihydrochloride (CAS 2306268-35-7) is a chemical compound with the molecular formula C8H11Cl2FN2 and a molecular weight of 225.09 g/mol. IUPAC name: 5-fluoro-2,3-dihydro-1H-indol-7-amine;dihydrochloride. InChIKey: JUZZRTQOQRSAJA-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2FN2 |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydro-1H-indol-7-amine;dihydrochloride |
| InChIKey | JUZZRTQOQRSAJA-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2N)F.Cl.Cl |
Computed by PubChem (NCBI)