cas: 1026265-04-2 — see every product listed under this CAS number, including other names
5-Fluoroquinolin-3-ol, 95%, 95% (CAS 1026265-04-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118YZ-100mg |
| cas | 1026265-04-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1629.20 Pln | |
| Chemat | 250mg | 2560.40 Pln | |
| Chemat | 1g | 6563.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-fluoroquinolin-3-ol (CAS 1026265-04-2) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 5-fluoroquinolin-3-ol. InChIKey: MFBCSCDTUVFSBG-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 5-fluoroquinolin-3-ol |
| InChIKey | MFBCSCDTUVFSBG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)O)C(=C1)F |
Computed by PubChem (NCBI)