cas: 917985-54-7 — see every product listed under this CAS number, including other names
5-Hexylthiopheneboronic acid pinacol ester, 95%, 95% (CAS 917985-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GXXF-100mg |
| cas | 917985-54-7 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 472.40 Pln | |
| Chemat | 10g | 870.80 Pln | |
| Chemat | 25g | 2051.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(5-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 917985-54-7) is a chemical compound with the molecular formula C16H27BO2S and a molecular weight of 294.3 g/mol. IUPAC name: 2-(5-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FWZQTJFOKCBQGX-UHFFFAOYSA-N.
| Molecular formula | C16H27BO2S |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 2-(5-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FWZQTJFOKCBQGX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CCCCCC |
Computed by PubChem (NCBI)