cas: 24985-85-1 — see every product listed under this CAS number, including other names
5-Hydroxy-1H-indole-2-carboxylic acid ethyl ester, 97% (CAS 24985-85-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040552-250MG |
| cas | 24985-85-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 1028.82 Pln | |
| Fluorochem | 10g | 1986.82 Pln | |
| Fluorochem | 25g | 4839.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-hydroxy-1H-indole-2-carboxylate (CAS 24985-85-1) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 5-hydroxy-1H-indole-2-carboxylate. InChIKey: WANAXLMRGYGCPC-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 5-hydroxy-1H-indole-2-carboxylate |
| InChIKey | WANAXLMRGYGCPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)O |
Computed by PubChem (NCBI)