CAS 88474-17-3 appears in our catalog under these names: 5-Iodo-8-methylquinoline, 98%, 98%, Quinoline, 5-iodo-8-methyl-, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-iodo-8-methylquinoline (CAS 88474-17-3) is a chemical compound with the molecular formula C10H8IN and a molecular weight of 269.08 g/mol. IUPAC name: 5-iodo-8-methylquinoline. InChIKey: LSFJJTNYFVXWTB-UHFFFAOYSA-N.
| Molecular formula | C10H8IN |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 5-iodo-8-methylquinoline |
| InChIKey | LSFJJTNYFVXWTB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)I)C=CC=N2 |
Computed by PubChem (NCBI)