CAS 215606-70-5 appears in our catalog under these names: 8-(Iodomethyl)quinoline, 97%, 8-(Iodomethyl)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
8-(iodomethyl)quinoline (CAS 215606-70-5) is a chemical compound with the molecular formula C10H8IN and a molecular weight of 269.08 g/mol. IUPAC name: 8-(iodomethyl)quinoline. InChIKey: RFYKJKSNQSDMNB-UHFFFAOYSA-N.
| Molecular formula | C10H8IN |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 8-(iodomethyl)quinoline |
| InChIKey | RFYKJKSNQSDMNB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CI)N=CC=C2 |
Computed by PubChem (NCBI)