CAS 851046-05-4 is the registry number for 1-Amino-4-iodonaphthalene, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
4-iodonaphthalen-1-amine (CAS 851046-05-4) is a chemical compound with the molecular formula C10H8IN and a molecular weight of 269.08 g/mol. IUPAC name: 4-iodonaphthalen-1-amine. InChIKey: AIZKSLYFNFNRRU-UHFFFAOYSA-N.
| Molecular formula | C10H8IN |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 4-iodonaphthalen-1-amine |
| InChIKey | AIZKSLYFNFNRRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2I)N |
Computed by PubChem (NCBI)